Products 5365-22-0

CAS 5365-22-0 is the registry number for 2,2-Dibromo-1-methylcyclopropanecarbonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2,2-dibromo-1-methylcyclopropane-1-carbonyl chloride (CAS 5365-22-0) is a chemical compound with the molecular formula C5H5Br2ClO and a molecular weight of 276.35 g/mol. IUPAC name: 2,2-dibromo-1-methylcyclopropane-1-carbonyl chloride. InChIKey: YBVMOPAXONJJDD-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5Br2ClO
Molecular weight276.35 g/mol
IUPAC name2,2-dibromo-1-methylcyclopropane-1-carbonyl chloride
InChIKeyYBVMOPAXONJJDD-UHFFFAOYSA-N
SMILESCC1(CC1(Br)Br)C(=O)Cl

Computed by PubChem (NCBI)