CAS 5367-26-0 appears in our catalog under these names: 3–Chloro–2–nitrotoluene, 3-Chloro-2-nitrotoluene, >96.0%(GC), 3-Chloro-2-nitrotoluene 98%, 3-Chloro-2-nitrotoluene 98+%, 3-Chloro-2-nitrotoluene, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 500g.
1-chloro-3-methyl-2-nitrobenzene (CAS 5367-26-0) is a chemical compound with the molecular formula C7H6ClNO2 and a molecular weight of 171.58 g/mol. IUPAC name: 1-chloro-3-methyl-2-nitrobenzene. InChIKey: JLDKNVUJLUGIBQ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2 |
|---|---|
| Molecular weight | 171.58 g/mol |
| IUPAC name | 1-chloro-3-methyl-2-nitrobenzene |
| InChIKey | JLDKNVUJLUGIBQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)