CAS 536741-53-4 appears in our catalog under these names: D-Glucosamine-3,6-di-O-sulphate sodium, D-Glucosamine-3,6-di-O-sulphate sodium s, alt, 2 mg, D-Glucosamine-3,6-di-O-sulphate sodium s, alt, 5 mg, D-Glucosamine-3,6-di-O-sulphate sodium s, alt, 10 mg, D-Glucosamine-3,6-di-O-sulphate sodium s, alt, 25 mg. Offered by: Biosynth, Roth. Available pack sizes: 5mg, 2mg, 10mg, 50mg, 25mg.
Disodium;[(2R,3R,4R,5R)-2-amino-4,5-dihydroxy-1-oxo-6-sulfonatooxyhexan-3-yl] sulfate (CAS 536741-53-4) is a chemical compound with the molecular formula C6H11NNa2O11S2 and a molecular weight of 383.3 g/mol. IUPAC name: disodium;[(2R,3R,4R,5R)-2-amino-4,5-dihydroxy-1-oxo-6-sulfonatooxyhexan-3-yl] sulfate. InChIKey: UJRQXYRXQGQVSS-FAOVPRGRSA-L.
| Molecular formula | C6H11NNa2O11S2 |
|---|---|
| Molecular weight | 383.3 g/mol |
| IUPAC name | disodium;[(2R,3R,4R,5R)-2-amino-4,5-dihydroxy-1-oxo-6-sulfonatooxyhexan-3-yl] sulfate |
| InChIKey | UJRQXYRXQGQVSS-FAOVPRGRSA-L |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C=O)N)OS(=O)(=O)[O-])O)O)OS(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)