CAS 536759-67-8 is the registry number for 3-Hydrazinylbenzamide Monohydrochloride. Offered by: TRC. Available pack sizes: 5g.
3-hydrazinylbenzamide;hydrochloride (CAS 536759-67-8) is a chemical compound with the molecular formula C7H10ClN3O and a molecular weight of 187.63 g/mol. IUPAC name: 3-hydrazinylbenzamide;hydrochloride. InChIKey: DFRKFVOTXZCNNX-UHFFFAOYSA-N.
| Molecular formula | C7H10ClN3O |
|---|---|
| Molecular weight | 187.63 g/mol |
| IUPAC name | 3-hydrazinylbenzamide;hydrochloride |
| InChIKey | DFRKFVOTXZCNNX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NN)C(=O)N.Cl |
Computed by PubChem (NCBI)