CAS 53676-22-5 is the registry number for 2,2,2-Tribromoethyl Dichlorophosphate. Offered by: TRC. Available pack sizes: 5g.
1,1,1-tribromo-2-dichlorophosphoryloxyethane (CAS 53676-22-5) is a chemical compound with the molecular formula C2H2Br3Cl2O2P and a molecular weight of 399.62 g/mol. IUPAC name: 1,1,1-tribromo-2-dichlorophosphoryloxyethane. InChIKey: RGBNHRWLNSWPPI-UHFFFAOYSA-N.
| Molecular formula | C2H2Br3Cl2O2P |
|---|---|
| Molecular weight | 399.62 g/mol |
| IUPAC name | 1,1,1-tribromo-2-dichlorophosphoryloxyethane |
| InChIKey | RGBNHRWLNSWPPI-UHFFFAOYSA-N |
| SMILES | C(C(Br)(Br)Br)OP(=O)(Cl)Cl |
Computed by PubChem (NCBI)