CAS 5369-03-9 appears in our catalog under these names: QX 314 chloride, QX-314 (chloride), ≥98%, ≥98%, QX-314 (chloride), 99.96%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 10mM (in 1ml dmso), 50mg, 250mg, 500mg, 25 mg.
[2-(2,6-dimethylanilino)-2-oxoethyl]-triethylazanium chloride (CAS 5369-03-9) is a chemical compound with the molecular formula C16H27ClN2O and a molecular weight of 298.8 g/mol. IUPAC name: [2-(2,6-dimethylanilino)-2-oxoethyl]-triethylazanium chloride. InChIKey: LLPPOMUAOGMYQI-UHFFFAOYSA-N.
| Molecular formula | C16H27ClN2O |
|---|---|
| Molecular weight | 298.8 g/mol |
| IUPAC name | [2-(2,6-dimethylanilino)-2-oxoethyl]-triethylazanium chloride |
| InChIKey | LLPPOMUAOGMYQI-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CC)CC(=O)NC1=C(C=CC=C1C)C.[Cl-] |
Computed by PubChem (NCBI)