Products 53696-69-8
CAS 53696-69-8 is the registry number for 2'-Deoxy-N-methyl-AMP. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3S,5R)-3-hydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate (CAS 53696-69-8) is a chemical compound with the molecular formula C11H16N5O6P and a molecular weight of 345.25 g/mol. IUPAC name: [(2R,3S,5R)-3-hydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate. InChIKey: MGKYNCZAQIZDCV-XLPZGREQSA-N.
| Molecular formula | C11H16N5O6P |
|---|---|
| Molecular weight | 345.25 g/mol |
| IUPAC name | [(2R,3S,5R)-3-hydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| InChIKey | MGKYNCZAQIZDCV-XLPZGREQSA-N |
| SMILES | CNC1=C2C(=NC=N1)N(C=N2)[C@H]3C[C@@H]([C@H](O3)COP(=O)(O)O)O |
Computed by PubChem (NCBI)