CAS 536974-84-2 appears in our catalog under these names: (4-Benzyloxy-3,5-dichlorophenyl)methanol, 95%, (4-(Benzyloxy)-3,5-dichlorophenyl)methanol, ≥95%, ≥95%, (4-Benzyloxy-3,5-dichlorophenyl)methanol. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
(3,5-dichloro-4-phenylmethoxyphenyl)methanol (CAS 536974-84-2) is a chemical compound with the molecular formula C14H12Cl2O2 and a molecular weight of 283.1 g/mol. IUPAC name: (3,5-dichloro-4-phenylmethoxyphenyl)methanol. InChIKey: ZOFBAUYIPFGTPD-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2O2 |
|---|---|
| Molecular weight | 283.1 g/mol |
| IUPAC name | (3,5-dichloro-4-phenylmethoxyphenyl)methanol |
| InChIKey | ZOFBAUYIPFGTPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Cl)CO)Cl |
Computed by PubChem (NCBI)