CAS 536975-50-5 is the registry number for (Difluoro(phenylsulfonyl)methyl)trimethylsilane, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g.
[benzenesulfonyl(difluoro)methyl]-trimethylsilane (CAS 536975-50-5) is a chemical compound with the molecular formula C10H14F2O2SSi and a molecular weight of 264.37 g/mol. IUPAC name: [benzenesulfonyl(difluoro)methyl]-trimethylsilane. InChIKey: YDFZZSDWIDCCJZ-UHFFFAOYSA-N.
| Molecular formula | C10H14F2O2SSi |
|---|---|
| Molecular weight | 264.37 g/mol |
| IUPAC name | [benzenesulfonyl(difluoro)methyl]-trimethylsilane |
| InChIKey | YDFZZSDWIDCCJZ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(F)(F)S(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)