CAS 537-45-1 appears in our catalog under these names: 2,6-Dibromoquinone-4-chloroimide, 2,6–Dibromoquinone–4–chloroimide, 2,6-Dibromoquinone-4-chloroimide, >98.0%(HPLC)(T), 2,6-Dibromo-4-(chloroimino)cyclohexa-2,5-dienone, 98%, 98%, 2,6-Dibromo-4-(chloroimino)cyclohexa-2,5-dienone. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 1g, 5g, 50g, 25g, 100g, 250g.
2,6-dibromo-4-chloroiminocyclohexa-2,5-dien-1-one (CAS 537-45-1) is a chemical compound with the molecular formula C6H2Br2ClNO and a molecular weight of 299.35 g/mol. IUPAC name: 2,6-dibromo-4-chloroiminocyclohexa-2,5-dien-1-one. InChIKey: JYWKEVKEKOTYEX-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2ClNO |
|---|---|
| Molecular weight | 299.35 g/mol |
| IUPAC name | 2,6-dibromo-4-chloroiminocyclohexa-2,5-dien-1-one |
| InChIKey | JYWKEVKEKOTYEX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)C(=CC1=NCl)Br)Br |
Computed by PubChem (NCBI)