CAS 537014-85-0 is the registry number for Perindopril Impurity 31. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2,3,4,5,6,7-hexahydro-1H-indole-2-carboxylic acid (CAS 537014-85-0) is a chemical compound with the molecular formula C9H13NO2 and a molecular weight of 167.20 g/mol. IUPAC name: (2S)-2,3,4,5,6,7-hexahydro-1H-indole-2-carboxylic acid. InChIKey: DAYHIOWULIYLFZ-QMMMGPOBSA-N.
| Molecular formula | C9H13NO2 |
|---|---|
| Molecular weight | 167.20 g/mol |
| IUPAC name | (2S)-2,3,4,5,6,7-hexahydro-1H-indole-2-carboxylic acid |
| InChIKey | DAYHIOWULIYLFZ-QMMMGPOBSA-N |
| SMILES | C1CCC2=C(C1)C[C@H](N2)C(=O)O |
Computed by PubChem (NCBI)