CAS 53716-82-8 appears in our catalog under these names: Dihydrolevoglucosenone, 95%, Cyrene, >95% (GC), Dihydrolevoglucosenone, (1S,5R)-6,8-Dioxabicyclo[3.2.1]octan-4-one 98%, CYRENE(TM) 2-METHYLTETRAHYDROFURAN BLEN&. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 1g, 100ml, 250ml, 50ml, 2l, 1l, 10g.
(1S,5R)-6,8-dioxabicyclo[3.2.1]octan-4-one (CAS 53716-82-8) is a chemical compound with the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. IUPAC name: (1S,5R)-6,8-dioxabicyclo[3.2.1]octan-4-one. InChIKey: WHIRALQRTSITMI-UJURSFKZSA-N.
| Molecular formula | C6H8O3 |
|---|---|
| Molecular weight | 128.13 g/mol |
| IUPAC name | (1S,5R)-6,8-dioxabicyclo[3.2.1]octan-4-one |
| InChIKey | WHIRALQRTSITMI-UJURSFKZSA-N |
| SMILES | C1CC(=O)[C@@H]2OC[C@H]1O2 |
Computed by PubChem (NCBI)