CAS 53726-70-8 is the registry number for Ornidazole Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,3-dichloropropyl)-2-methyl-5-nitroimidazole (CAS 53726-70-8) is a chemical compound with the molecular formula C7H9Cl2N3O2 and a molecular weight of 238.07 g/mol. IUPAC name: 1-(2,3-dichloropropyl)-2-methyl-5-nitroimidazole. InChIKey: HHZILRSEIZXVTQ-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N3O2 |
|---|---|
| Molecular weight | 238.07 g/mol |
| IUPAC name | 1-(2,3-dichloropropyl)-2-methyl-5-nitroimidazole |
| InChIKey | HHZILRSEIZXVTQ-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1CC(CCl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)