CAS 53775-07-8 is the registry number for Des-N,N-diethylethanamine 4-Hydroxyclomiphene. Offered by: TRC. Available pack sizes: 250mg.
4-(2-chloro-1,2-diphenylethenyl)phenol (CAS 53775-07-8) is a chemical compound with the molecular formula C20H15ClO and a molecular weight of 306.8 g/mol. IUPAC name: 4-(2-chloro-1,2-diphenylethenyl)phenol. InChIKey: UUZKUFVAKHXHHC-UHFFFAOYSA-N.
| Molecular formula | C20H15ClO |
|---|---|
| Molecular weight | 306.8 g/mol |
| IUPAC name | 4-(2-chloro-1,2-diphenylethenyl)phenol |
| InChIKey | UUZKUFVAKHXHHC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)Cl)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)