CAS 5378-32-5 is the registry number for 2-(3-Fluorophenyl)-1,3,4-oxadiazole, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-(3-fluorophenyl)-1,3,4-oxadiazole (CAS 5378-32-5) is a chemical compound with the molecular formula C8H5FN2O and a molecular weight of 164.14 g/mol. IUPAC name: 2-(3-fluorophenyl)-1,3,4-oxadiazole. InChIKey: LXPMVAYGVNNNIB-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O |
|---|---|
| Molecular weight | 164.14 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-1,3,4-oxadiazole |
| InChIKey | LXPMVAYGVNNNIB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NN=CO2 |
Computed by PubChem (NCBI)