CAS 53780-81-7 is the registry number for Molybdenum(v) trichloride-isopropoxide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 50g.
Bis(propan-2-ol);trichloromolybdenum (CAS 53780-81-7) is a chemical compound with the molecular formula C6H16Cl3MoO2 and a molecular weight of 322.5 g/mol. IUPAC name: bis(propan-2-ol);trichloromolybdenum. InChIKey: JVWWBSIISOXHDE-UHFFFAOYSA-K.
| Molecular formula | C6H16Cl3MoO2 |
|---|---|
| Molecular weight | 322.5 g/mol |
| IUPAC name | bis(propan-2-ol);trichloromolybdenum |
| InChIKey | JVWWBSIISOXHDE-UHFFFAOYSA-K |
| SMILES | CC(C)O.CC(C)O.Cl[Mo](Cl)Cl |
Computed by PubChem (NCBI)