CAS 53784-33-1 appears in our catalog under these names: 2,3,4–TRI–O–ACETYL–BETA–D–XYLOPYRANOSYL AZIDE, 2,3,4-Tri-O-acetyl-β-D-xylopyranosyl azide, 2,3,4-Tri-O-acetyl-b-D-xylopyranosyl azide. Offered by: GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 2g, 10g, 5g.
[(3R,4S,5R,6R)-4,5-diacetyloxy-6-azidooxan-3-yl] acetate (CAS 53784-33-1) is a chemical compound with the molecular formula C11H15N3O7 and a molecular weight of 301.25 g/mol. IUPAC name: [(3R,4S,5R,6R)-4,5-diacetyloxy-6-azidooxan-3-yl] acetate. InChIKey: LMAJKBXVWKPVDF-LMLFDSFASA-N.
| Molecular formula | C11H15N3O7 |
|---|---|
| Molecular weight | 301.25 g/mol |
| IUPAC name | [(3R,4S,5R,6R)-4,5-diacetyloxy-6-azidooxan-3-yl] acetate |
| InChIKey | LMAJKBXVWKPVDF-LMLFDSFASA-N |
| SMILES | CC(=O)O[C@@H]1CO[C@H]([C@@H]([C@H]1OC(=O)C)OC(=O)C)N=[N+]=[N-] |
Computed by PubChem (NCBI)