CAS 5379-77-1 appears in our catalog under these names: 2,6-Diphenylbenzo[1,2-b:4,5-b']difuran, 95%, 2,6-Diphenylbenzo(1,2-b:4,5-b')difuran, 95+%, 2,6–Diphenylbenzo(1,2–b：4,5–b')difuran, 2,6-Diphenylbenzo[1,2-b:4,5-b']difuran. Offered by: Combi-blocks, AmBeed, GLPBio, TCI. Available pack sizes: 1g, 200mg, 250mg.
2,6-diphenylfuro[2,3-f][1]benzofuran (CAS 5379-77-1) is a chemical compound with the molecular formula C22H14O2 and a molecular weight of 310.3 g/mol. IUPAC name: 2,6-diphenylfuro[2,3-f][1]benzofuran. InChIKey: QDHGBWBEBOMJCI-UHFFFAOYSA-N.
| Molecular formula | C22H14O2 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 2,6-diphenylfuro[2,3-f][1]benzofuran |
| InChIKey | QDHGBWBEBOMJCI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=CC4=C(C=C(O4)C5=CC=CC=C5)C=C3O2 |
Computed by PubChem (NCBI)