CAS 53798-97-3 appears in our catalog under these names: 1,2-Dimethyl 2-hydroxy-1,2,3-propanetricarboxylate, 97%, 97%, dimethyl citrate, 97%, 1,2-Dimethyl Citrate, Dimethyl Citric acid, Dimethyl Citric acid, 97.0%. Offered by: Chemat, Fluorochem, TRC, GLPBio, MedChemExpress. Available pack sizes: 25mg, 1g, 10mM/1mL, 25 mg, 50 mg, 100 mg.
3-hydroxy-5-methoxy-3-methoxycarbonyl-5-oxopentanoic acid (CAS 53798-97-3) is a chemical compound with the molecular formula C8H12O7 and a molecular weight of 220.18 g/mol. IUPAC name: 3-hydroxy-5-methoxy-3-methoxycarbonyl-5-oxopentanoic acid. InChIKey: OMIHCBSQSYMFDP-UHFFFAOYSA-N.
| Molecular formula | C8H12O7 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 3-hydroxy-5-methoxy-3-methoxycarbonyl-5-oxopentanoic acid |
| InChIKey | OMIHCBSQSYMFDP-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(CC(=O)O)(C(=O)OC)O |
Computed by PubChem (NCBI)