CAS 5382-00-3 is the registry number for diphenyl chlorophosphite. Offered by: GLPBio. Available pack sizes: 1g.
Chloro(diphenoxy)phosphane (CAS 5382-00-3) is a chemical compound with the molecular formula C12H10ClO2P and a molecular weight of 252.63 g/mol. IUPAC name: chloro(diphenoxy)phosphane. InChIKey: VFYNVDRWOAJSKI-UHFFFAOYSA-N.
| Molecular formula | C12H10ClO2P |
|---|---|
| Molecular weight | 252.63 g/mol |
| IUPAC name | chloro(diphenoxy)phosphane |
| InChIKey | VFYNVDRWOAJSKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OP(OC2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)