CAS 53823-68-0 appears in our catalog under these names: Phosphoenolpyruvic acid monosodium salt hydrate, Sodium 1-Carboxyvinyl Hydrogenphosphate, ≥97%(enzymatic), ≥97%(enzymatic), Phosphoenolpyruvic acid (monosodium), Sodium 1-carboxyvinyl hydrogenphosphate, ≥97%(enzymatic). Offered by: Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 0,5g, 0,25g, 1g, 5g, 100mg, 250mg, 100 mg, 50 mg.
Sodium 1-carboxyethenyl hydrogen phosphate (CAS 53823-68-0) is a chemical compound with the molecular formula C3H4NaO6P and a molecular weight of 190.02 g/mol. IUPAC name: sodium 1-carboxyethenyl hydrogen phosphate. InChIKey: NESXXUAWVHXRGX-UHFFFAOYSA-M.
| Molecular formula | C3H4NaO6P |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | sodium 1-carboxyethenyl hydrogen phosphate |
| InChIKey | NESXXUAWVHXRGX-UHFFFAOYSA-M |
| SMILES | C=C(C(=O)O)OP(=O)(O)[O-].[Na+] |
Computed by PubChem (NCBI)