CAS 53826-13-4 appears in our catalog under these names: 2-Perfluorodecyl Ethanoic Acid, 2H,2H-Perfluorododecanoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-Heneicosafluorododecanoic acid, 95%, 95%. Offered by: TRC, Dr. Ehrenstorfer, Chemat, HPC Standards. Available pack sizes: 25mg, 5mg, 1x25mg.
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecanoic acid (CAS 53826-13-4) is a chemical compound with the molecular formula C12H3F21O2 and a molecular weight of 578.12 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecanoic acid. InChIKey: IKHNVATUHWDNGI-UHFFFAOYSA-N.
| Molecular formula | C12H3F21O2 |
|---|---|
| Molecular weight | 578.12 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecanoic acid |
| InChIKey | IKHNVATUHWDNGI-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)