CAS 5384-55-4 appears in our catalog under these names: 1-(2-Hydroxy-3,4-dimethylphenyl)ethan-1-one, 95%, 1-(2-Hydroxy-3,4-dimethylphenyl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
1-(2-hydroxy-3,4-dimethylphenyl)ethanone (CAS 5384-55-4) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: 1-(2-hydroxy-3,4-dimethylphenyl)ethanone. InChIKey: GJDBXQYWESNHSU-UHFFFAOYSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | 1-(2-hydroxy-3,4-dimethylphenyl)ethanone |
| InChIKey | GJDBXQYWESNHSU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)C)O)C |
Computed by PubChem (NCBI)