Products 53852-97-4
CAS 53852-97-4 is the registry number for 5,5-Dimethyl-2-(3-oxo-1,3-diphenylpropyl)cyclohexane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5,5-dimethyl-2-(3-oxo-1,3-diphenylpropyl)cyclohexane-1,3-dione (CAS 53852-97-4) is a chemical compound with the molecular formula C23H24O3 and a molecular weight of 348.4 g/mol. IUPAC name: 5,5-dimethyl-2-(3-oxo-1,3-diphenylpropyl)cyclohexane-1,3-dione. InChIKey: SNSWUHHPTHNZNQ-UHFFFAOYSA-N.
| Molecular formula | C23H24O3 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 5,5-dimethyl-2-(3-oxo-1,3-diphenylpropyl)cyclohexane-1,3-dione |
| InChIKey | SNSWUHHPTHNZNQ-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C(C(=O)C1)C(CC(=O)C2=CC=CC=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)