Products 5386-57-2
CAS 5386-57-2 is the registry number for Dinopenton. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 1mg, 2mg, 5mg, 10mg.
(2,4-dinitro-6-pentan-2-ylphenyl) propan-2-yl carbonate (CAS 5386-57-2) is a chemical compound with the molecular formula C15H20N2O7 and a molecular weight of 340.33 g/mol. IUPAC name: (2,4-dinitro-6-pentan-2-ylphenyl) propan-2-yl carbonate. InChIKey: QQHRSBLQLJPBPJ-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O7 |
|---|---|
| Molecular weight | 340.33 g/mol |
| IUPAC name | (2,4-dinitro-6-pentan-2-ylphenyl) propan-2-yl carbonate |
| InChIKey | QQHRSBLQLJPBPJ-UHFFFAOYSA-N |
| SMILES | CCCC(C)C1=C(C(=CC(=C1)[N+](=O)[O-])[N+](=O)[O-])OC(=O)OC(C)C |
Computed by PubChem (NCBI)