Products 53902-76-4
CAS 53902-76-4 appears in our catalog under these names: Pyrazolo[1,5-a]pyrazine-3-carboxylic acid, 95%, Pyrazolo(1,5-a)pyrazine-3-carboxylic acid, Pyrazolo[1,5-a]pyrazine-3-carboxylic acid 95%, Pyrazolo[1,5-a]pyrazine-3-carboxylic acid, 95%, 95%, PYRAZOLO[1,5-A]PYRAZINE-3-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 0,5g, 5g, 100mg, 10g.
Pyrazolo[1,5-a]pyrazine-3-carboxylic acid (CAS 53902-76-4) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: pyrazolo[1,5-a]pyrazine-3-carboxylic acid. InChIKey: KDZOHLVVUNZUQC-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | pyrazolo[1,5-a]pyrazine-3-carboxylic acid |
| InChIKey | KDZOHLVVUNZUQC-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C=N2)C(=O)O)C=N1 |
Computed by PubChem (NCBI)