Products 53902-89-9

CAS 53902-89-9 is the registry number for 3-Bromo-2-methylpyrazolo[1,5-b]pyridazine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-bromo-2-methylpyrazolo[1,5-b]pyridazine (CAS 53902-89-9) is a chemical compound with the molecular formula C7H6BrN3 and a molecular weight of 212.05 g/mol. IUPAC name: 3-bromo-2-methylpyrazolo[1,5-b]pyridazine. InChIKey: UNXAKLMSJLQAID-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BrN3
Molecular weight212.05 g/mol
IUPAC name3-bromo-2-methylpyrazolo[1,5-b]pyridazine
InChIKeyUNXAKLMSJLQAID-UHFFFAOYSA-N
SMILESCC1=NN2C(=C1Br)C=CC=N2

Computed by PubChem (NCBI)