CAS 53910-10-4 appears in our catalog under these names: 6–Iodoisobenzofuran–1(3H)–one, 6-Iodoisobenzofuran-1(3H)-one 97%, 6-Iodoisobenzofuran-1(3H)-one, 97%, 97%, 6-Iodo-3 H -isobenzofuran-1-one, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg.
6-iodo-3H-2-benzofuran-1-one (CAS 53910-10-4) is a chemical compound with the molecular formula C8H5IO2 and a molecular weight of 260.03 g/mol. IUPAC name: 6-iodo-3H-2-benzofuran-1-one. InChIKey: GDWUNKJJSAKJSC-UHFFFAOYSA-N.
| Molecular formula | C8H5IO2 |
|---|---|
| Molecular weight | 260.03 g/mol |
| IUPAC name | 6-iodo-3H-2-benzofuran-1-one |
| InChIKey | GDWUNKJJSAKJSC-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)I)C(=O)O1 |
Computed by PubChem (NCBI)