CAS 5392-67-6 is the registry number for p–Nitrobenzene–diazo–amino–azobenzene. Offered by: GLPBio. Available pack sizes: 1g, 5g.
N-[(4-nitrophenyl)diazenyl]-4-phenyldiazenylaniline (CAS 5392-67-6) is a chemical compound with the molecular formula C18H14N6O2 and a molecular weight of 346.3 g/mol. IUPAC name: N-[(4-nitrophenyl)diazenyl]-4-phenyldiazenylaniline. InChIKey: SMMIDVLUFMPWFN-UHFFFAOYSA-N.
| Molecular formula | C18H14N6O2 |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | N-[(4-nitrophenyl)diazenyl]-4-phenyldiazenylaniline |
| InChIKey | SMMIDVLUFMPWFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)NN=NC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)