CAS 53926-89-9 appears in our catalog under these names: Thioridazine EP Impurity D, Thioridazine EP Impurity D (Mixture of Diastereomers), 10-(2-((2RS)-1-Methylpiperidin-2-yl)ethyl)-2-(methylsulfinyl)-10H-phenothiazine 5-Oxide (Mesoridazine 5-Sulfoxide), Thioridazine Disulfoxide, >95% (HPLC), Thioridazine impurity 2. Offered by: Chemat Brand, Mikromol, TRC, MedChemExpress. Available pack sizes: on request, 25mg, 100mg, 10mg, 50mg, Get quote.
10-[2-(1-methylpiperidin-2-yl)ethyl]-2-methylsulfinylphenothiazine 5-oxide (CAS 53926-89-9) is a chemical compound with the molecular formula C21H26N2O2S2 and a molecular weight of 402.6 g/mol. IUPAC name: 10-[2-(1-methylpiperidin-2-yl)ethyl]-2-methylsulfinylphenothiazine 5-oxide. InChIKey: DWOCAVXFXSJKQE-UHFFFAOYSA-N.
| Molecular formula | C21H26N2O2S2 |
|---|---|
| Molecular weight | 402.6 g/mol |
| IUPAC name | 10-[2-(1-methylpiperidin-2-yl)ethyl]-2-methylsulfinylphenothiazine 5-oxide |
| InChIKey | DWOCAVXFXSJKQE-UHFFFAOYSA-N |
| SMILES | CN1CCCCC1CCN2C3=CC=CC=C3S(=O)C4=C2C=C(C=C4)S(=O)C |
Computed by PubChem (NCBI)