CAS 53947-90-3 is the registry number for Edgeworthin, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg.
6,7-dihydroxy-3-(2-oxochromen-7-yl)oxychromen-2-one (CAS 53947-90-3) is a chemical compound with the molecular formula C18H10O7 and a molecular weight of 338.3 g/mol. IUPAC name: 6,7-dihydroxy-3-(2-oxochromen-7-yl)oxychromen-2-one. InChIKey: IBZKIELXVOINHR-UHFFFAOYSA-N.
| Molecular formula | C18H10O7 |
|---|---|
| Molecular weight | 338.3 g/mol |
| IUPAC name | 6,7-dihydroxy-3-(2-oxochromen-7-yl)oxychromen-2-one |
| InChIKey | IBZKIELXVOINHR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=O)O2)OC3=CC4=CC(=C(C=C4OC3=O)O)O |
Computed by PubChem (NCBI)