CAS 53948-12-2 is the registry number for Fomentariol. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,3,4,6-tetrahydroxy-1,7-bis[(E)-3-hydroxyprop-1-enyl]benzo[7]annulen-5-one (CAS 53948-12-2) is a chemical compound with the molecular formula C17H16O7 and a molecular weight of 332.3 g/mol. IUPAC name: 2,3,4,6-tetrahydroxy-1,7-bis[(E)-3-hydroxyprop-1-enyl]benzo[7]annulen-5-one. InChIKey: VWFRIRTWXNOGIL-ZPUQHVIOSA-N.
| Molecular formula | C17H16O7 |
|---|---|
| Molecular weight | 332.3 g/mol |
| IUPAC name | 2,3,4,6-tetrahydroxy-1,7-bis[(E)-3-hydroxyprop-1-enyl]benzo[7]annulen-5-one |
| InChIKey | VWFRIRTWXNOGIL-ZPUQHVIOSA-N |
| SMILES | C1=CC2=C(C(=C(C(=C2C(=O)C(=C1/C=C/CO)O)O)O)O)/C=C/CO |
Computed by PubChem (NCBI)