Products 53948-36-0

CAS 53948-36-0 is the registry number for 2,4-Dibromo-6-methoxyphenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2,4-dibromo-6-methoxyphenol (CAS 53948-36-0) is a chemical compound with the molecular formula C7H6Br2O2 and a molecular weight of 281.93 g/mol. IUPAC name: 2,4-dibromo-6-methoxyphenol. InChIKey: LAONXLSELHLPBP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6Br2O2
Molecular weight281.93 g/mol
IUPAC name2,4-dibromo-6-methoxyphenol
InChIKeyLAONXLSELHLPBP-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC(=C1)Br)Br)O

Computed by PubChem (NCBI)