Products 53966-34-0
CAS 53966-34-0 is the registry number for Floxacrine. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-chloro-10-hydroxy-3-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-acridine-1,9-dione (CAS 53966-34-0) is a chemical compound with the molecular formula C20H13ClF3NO3 and a molecular weight of 407.8 g/mol. IUPAC name: 7-chloro-10-hydroxy-3-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-acridine-1,9-dione. InChIKey: AWHZKKVSUJJVNL-UHFFFAOYSA-N.
| Molecular formula | C20H13ClF3NO3 |
|---|---|
| Molecular weight | 407.8 g/mol |
| IUPAC name | 7-chloro-10-hydroxy-3-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-acridine-1,9-dione |
| InChIKey | AWHZKKVSUJJVNL-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)C2=C1N(C3=C(C2=O)C=C(C=C3)Cl)O)C4=CC=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)