Products 53976-62-8
CAS 53976-62-8 is the registry number for 2,5-Dichloro-pyridine 1-oxide, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2,5-dichloro-1-oxidopyridin-1-ium (CAS 53976-62-8) is a chemical compound with the molecular formula C5H3Cl2NO and a molecular weight of 163.99 g/mol. IUPAC name: 2,5-dichloro-1-oxidopyridin-1-ium. InChIKey: HEILCVAZOYRMJU-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2NO |
|---|---|
| Molecular weight | 163.99 g/mol |
| IUPAC name | 2,5-dichloro-1-oxidopyridin-1-ium |
| InChIKey | HEILCVAZOYRMJU-UHFFFAOYSA-N |
| SMILES | C1=CC(=[N+](C=C1Cl)[O-])Cl |
Computed by PubChem (NCBI)