CAS 5398-27-6 appears in our catalog under these names: 2,6–Diiodo–4–nitroaniline, 2,6-Diiodo-4-nitroaniline, >98.0%(GC), 2,6-Diiodo-4-nitroaniline 95%, 2,6-DIIODO-4-NITROANILINE, 97%, 2,6-Diiodo-4-Nitroaniline, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 25g, 1g, 10g, 100g, 250mg, 50g, 500g.
2,6-diiodo-4-nitroaniline (CAS 5398-27-6) is a chemical compound with the molecular formula C6H4I2N2O2 and a molecular weight of 389.92 g/mol. IUPAC name: 2,6-diiodo-4-nitroaniline. InChIKey: YPVYMWQYENWFAT-UHFFFAOYSA-N.
| Molecular formula | C6H4I2N2O2 |
|---|---|
| Molecular weight | 389.92 g/mol |
| IUPAC name | 2,6-diiodo-4-nitroaniline |
| InChIKey | YPVYMWQYENWFAT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1I)N)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)