Products 53980-88-4

CAS 53980-88-4 is the registry number for 5(or 6)-carboxy-4-hexylcyclohex-2-ene-1-octanoic acid. Offered by: Chemat. Available pack sizes: 100g, 500g, 2.5kg.

Structural formula: {0} (CAS {1})

5-(7-carboxyheptyl)-2-hexylcyclohex-3-ene-1-carboxylic acid (CAS 53980-88-4) is a chemical compound with the molecular formula C21H36O4 and a molecular weight of 352.5 g/mol. IUPAC name: 5-(7-carboxyheptyl)-2-hexylcyclohex-3-ene-1-carboxylic acid. InChIKey: RYKIXDBAIYMFDV-UHFFFAOYSA-N.

Identity
Molecular formulaC21H36O4
Molecular weight352.5 g/mol
IUPAC name5-(7-carboxyheptyl)-2-hexylcyclohex-3-ene-1-carboxylic acid
InChIKeyRYKIXDBAIYMFDV-UHFFFAOYSA-N
SMILESCCCCCCC1C=CC(CC1C(=O)O)CCCCCCCC(=O)O

Computed by PubChem (NCBI)