Products 539813-69-9
CAS 539813-69-9 appears in our catalog under these names: PPAR agonist 1, PPAR agonist 1, 96%, 96%, PPAR agonist 1, 98.39%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 1 mg, 5 mg.
(2S)-2-methoxy-3-[4-[3-(4-methylsulfonyloxyphenyl)propylamino]phenyl]propanoic acid (CAS 539813-69-9) is a chemical compound with the molecular formula C20H25NO6S and a molecular weight of 407.5 g/mol. IUPAC name: (2S)-2-methoxy-3-[4-[3-(4-methylsulfonyloxyphenyl)propylamino]phenyl]propanoic acid. InChIKey: HFRCAKXUSHNVLY-IBGZPJMESA-N.
| Molecular formula | C20H25NO6S |
|---|---|
| Molecular weight | 407.5 g/mol |
| IUPAC name | (2S)-2-methoxy-3-[4-[3-(4-methylsulfonyloxyphenyl)propylamino]phenyl]propanoic acid |
| InChIKey | HFRCAKXUSHNVLY-IBGZPJMESA-N |
| SMILES | CO[C@@H](CC1=CC=C(C=C1)NCCCC2=CC=C(C=C2)OS(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
PPAR agonist 1, orb1710283