CAS 5400-94-2 appears in our catalog under these names: N–Benzyl–N,N–diethylethanaminium iodide, Benzyltriethylammonium Iodide, >98.0%(T)(HPLC), Benzenemethanaminium, N,N,N-triethyl-, iodide (1:1), 98%, 98%, N-Benzyl-N,N-diethylethanaminium iodide, 98.0%, N-Benzyl-N,N-diethylethanaminium iodide, 98%. Offered by: GLPBio, TCI, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 100g, 50g, 10 g, 5 g.
Benzyl(triethyl)azanium iodide (CAS 5400-94-2) is a chemical compound with the molecular formula C13H22IN and a molecular weight of 319.22 g/mol. IUPAC name: benzyl(triethyl)azanium iodide. InChIKey: JWLJBISFJGEYMT-UHFFFAOYSA-M.
| Molecular formula | C13H22IN |
|---|---|
| Molecular weight | 319.22 g/mol |
| IUPAC name | benzyl(triethyl)azanium iodide |
| InChIKey | JWLJBISFJGEYMT-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CC1=CC=CC=C1.[I-] |
Computed by PubChem (NCBI)