CAS 54009-81-3 is the registry number for 3-(Perfluoro-3-Methylbutyl)-1,2-Propenoxide. Offered by: Biosynth. Available pack sizes: 0,1g, 0,25g, 0,5g, 1g.
2-[2,2,3,3,4,5,5,5-octafluoro-4-(trifluoromethyl)pentyl]oxirane (CAS 54009-81-3) is a chemical compound with the molecular formula C8H5F11O and a molecular weight of 326.11 g/mol. IUPAC name: 2-[2,2,3,3,4,5,5,5-octafluoro-4-(trifluoromethyl)pentyl]oxirane. InChIKey: BKXKCZGEIQKTBI-UHFFFAOYSA-N.
| Molecular formula | C8H5F11O |
|---|---|
| Molecular weight | 326.11 g/mol |
| IUPAC name | 2-[2,2,3,3,4,5,5,5-octafluoro-4-(trifluoromethyl)pentyl]oxirane |
| InChIKey | BKXKCZGEIQKTBI-UHFFFAOYSA-N |
| SMILES | C1C(O1)CC(C(C(C(F)(F)F)(C(F)(F)F)F)(F)F)(F)F |
Computed by PubChem (NCBI)