CAS 5401-94-5 appears in our catalog under these names: 5–Nitroindazole, 5-Nitroindazole, 5-Nitroindazole 98%, 5-Nitroindazole, >98.0%(GC), 5-Nitro-1H-indazole, 98+% . Offered by: GLPBio, Biosynth, Ambeed, TCI, Thermo Scientific (Alfa Aesar). Available pack sizes: 100g, 500g, 1kg, 2kg, 5g, 25g, 1000g, 10g.
5-nitro-1H-indazole (CAS 5401-94-5) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 5-nitro-1H-indazole. InChIKey: WSGURAYTCUVDQL-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 5-nitro-1H-indazole |
| InChIKey | WSGURAYTCUVDQL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C=NN2 |
Computed by PubChem (NCBI)