CAS 5405-63-0 appears in our catalog under these names: Triphenylphosphine,1,4–benzoquinone adduct, Triphenylphosphine-1,4-Benzoquinone Adduct 97%, Triphenylphosphine-1,4-Benzoquinone Adduct, 97%, 97%, 4-Hydroxy-2-(triphenylphosphonio)phenolate, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 500g.
(2,5-dihydroxyphenyl)-triphenylphosphanium (CAS 5405-63-0) is a chemical compound with the molecular formula C24H20O2P+ and a molecular weight of 371.4 g/mol. IUPAC name: (2,5-dihydroxyphenyl)-triphenylphosphanium. InChIKey: YCXVHURLDBUOMW-UHFFFAOYSA-O.
| Molecular formula | C24H20O2P+ |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | (2,5-dihydroxyphenyl)-triphenylphosphanium |
| InChIKey | YCXVHURLDBUOMW-UHFFFAOYSA-O |
| SMILES | C1=CC=C(C=C1)[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=C(C=CC(=C4)O)O |
Computed by PubChem (NCBI)