CAS 540529-98-4 is the registry number for 2-Chloro-N-(3,4-dichlorobenzyl)nicotinamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N-[(3,4-dichlorophenyl)methyl]pyridine-3-carboxamide (CAS 540529-98-4) is a chemical compound with the molecular formula C13H9Cl3N2O and a molecular weight of 315.6 g/mol. IUPAC name: 2-chloro-N-[(3,4-dichlorophenyl)methyl]pyridine-3-carboxamide. InChIKey: PCIMBMBKVBSANF-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl3N2O |
|---|---|
| Molecular weight | 315.6 g/mol |
| IUPAC name | 2-chloro-N-[(3,4-dichlorophenyl)methyl]pyridine-3-carboxamide |
| InChIKey | PCIMBMBKVBSANF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Cl)C(=O)NCC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)