Products 54057-58-8

CAS 54057-58-8 is the registry number for 2-{Bicyclo(2.2.1)heptan-2-yl}acetyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(2-bicyclo[2.2.1]heptanyl)acetyl chloride (CAS 54057-58-8) is a chemical compound with the molecular formula C9H13ClO and a molecular weight of 172.65 g/mol. IUPAC name: 2-(2-bicyclo[2.2.1]heptanyl)acetyl chloride. InChIKey: SGEBCUSJUMCJGH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13ClO
Molecular weight172.65 g/mol
IUPAC name2-(2-bicyclo[2.2.1]heptanyl)acetyl chloride
InChIKeySGEBCUSJUMCJGH-UHFFFAOYSA-N
SMILESC1CC2CC1CC2CC(=O)Cl

Computed by PubChem (NCBI)