CAS 54081-32-2 appears in our catalog under these names: 2,3,4,5,6-Pentafluorochalcone, 95%, 2-Propen-1-one, 3-(pentafluorophenyl)-1-phenyl-, (2E)-, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, on request.
(E)-3-(2,3,4,5,6-pentafluorophenyl)-1-phenylprop-2-en-1-one (CAS 54081-32-2) is a chemical compound with the molecular formula C15H7F5O and a molecular weight of 298.21 g/mol. IUPAC name: (E)-3-(2,3,4,5,6-pentafluorophenyl)-1-phenylprop-2-en-1-one. InChIKey: JIOFBHNILKPQLI-VOTSOKGWSA-N.
| Molecular formula | C15H7F5O |
|---|---|
| Molecular weight | 298.21 g/mol |
| IUPAC name | (E)-3-(2,3,4,5,6-pentafluorophenyl)-1-phenylprop-2-en-1-one |
| InChIKey | JIOFBHNILKPQLI-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)/C=C/C2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)