CAS 5409-66-5 appears in our catalog under these names: Fluoxetine Impurity 1, Fluoxetine Impurity 36, Fluoxetine Impurity 16. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(4-hydroxy-1-methyl-4-phenylpiperidin-3-yl)-phenylmethanone (CAS 5409-66-5) is a chemical compound with the molecular formula C19H21NO2 and a molecular weight of 295.4 g/mol. IUPAC name: (4-hydroxy-1-methyl-4-phenylpiperidin-3-yl)-phenylmethanone. InChIKey: TVRFABREAYQAQA-UHFFFAOYSA-N.
| Molecular formula | C19H21NO2 |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | (4-hydroxy-1-methyl-4-phenylpiperidin-3-yl)-phenylmethanone |
| InChIKey | TVRFABREAYQAQA-UHFFFAOYSA-N |
| SMILES | CN1CCC(C(C1)C(=O)C2=CC=CC=C2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)