CAS 541-22-0 appears in our catalog under these names: Decamethonium bromide, 98%, Decamethonium Bromide, >95% (HPLC), Decamethonium bromide/ 99.79% (existing batch purity), Decamethonium Bromide, Decamethonium bromide. Offered by: Combi-blocks, Chemat Brand, TRC, TargetMol, GLPBio. Available pack sizes: 25g, 1g, 5g, on request, 10g, 500mg, 10mM (in 1ml dmso), 50mg.
Trimethyl-[10-(trimethylazaniumyl)decyl]azanium dibromide (CAS 541-22-0) is a chemical compound with the molecular formula C16H38Br2N2 and a molecular weight of 418.3 g/mol. IUPAC name: trimethyl-[10-(trimethylazaniumyl)decyl]azanium dibromide. InChIKey: HLXQFVXURMXRPU-UHFFFAOYSA-L.
| Molecular formula | C16H38Br2N2 |
|---|---|
| Molecular weight | 418.3 g/mol |
| IUPAC name | trimethyl-[10-(trimethylazaniumyl)decyl]azanium dibromide |
| InChIKey | HLXQFVXURMXRPU-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)CCCCCCCCCC[N+](C)(C)C.[Br-].[Br-] |
Computed by PubChem (NCBI)