Products 541-66-2

CAS 541-66-2 is the registry number for Oxapropanium Iodide. Offered by: TRC, Biosynth. Available pack sizes: 1g, 1000mg, 500mg.

Structural formula: {0} (CAS {1})

1,3-dioxolan-4-ylmethyl(trimethyl)azanium iodide (CAS 541-66-2) is a chemical compound with the molecular formula C7H16INO2 and a molecular weight of 273.11 g/mol. IUPAC name: 1,3-dioxolan-4-ylmethyl(trimethyl)azanium iodide. InChIKey: HQWAEQCLIWVOMF-UHFFFAOYSA-M.

Identity
Molecular formulaC7H16INO2
Molecular weight273.11 g/mol
IUPAC name1,3-dioxolan-4-ylmethyl(trimethyl)azanium iodide
InChIKeyHQWAEQCLIWVOMF-UHFFFAOYSA-M
SMILESC[N+](C)(C)CC1COCO1.[I-]

Computed by PubChem (NCBI)