CAS 5410-29-7 is the registry number for 2-Nitrophenylarsonic Acid, >98.0%(T). Offered by: TCI. Available pack sizes: 1g, 25g.
(2-nitrophenyl)arsonic acid (CAS 5410-29-7) is a chemical compound with the molecular formula C6H6AsNO5 and a molecular weight of 247.04 g/mol. IUPAC name: (2-nitrophenyl)arsonic acid. InChIKey: UYEDGVZDGVIURN-UHFFFAOYSA-N.
| Molecular formula | C6H6AsNO5 |
|---|---|
| Molecular weight | 247.04 g/mol |
| IUPAC name | (2-nitrophenyl)arsonic acid |
| InChIKey | UYEDGVZDGVIURN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])[As](=O)(O)O |
Computed by PubChem (NCBI)