CAS 5410-78-6 is the registry number for p-Aminophenyldichloroarsine hydrochloride. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg, 10000mg.
4-dichloroarsanylaniline;hydrochloride (CAS 5410-78-6) is a chemical compound with the molecular formula C6H7AsCl3N and a molecular weight of 274.4 g/mol. IUPAC name: 4-dichloroarsanylaniline;hydrochloride. InChIKey: WXNHRNHYHZWRNQ-UHFFFAOYSA-N.
| Molecular formula | C6H7AsCl3N |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 4-dichloroarsanylaniline;hydrochloride |
| InChIKey | WXNHRNHYHZWRNQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)[As](Cl)Cl.Cl |
Computed by PubChem (NCBI)